124-48-1 Chlorodibromomethane
| ürün Ad? |
Chlorodibromomethane |
| ingilizce ad? |
Chlorodibromomethane; Dibromochloromethane |
| Moleküler Formülü |
CHBr2Cl |
| Molekül A??rl??? |
208.2796 |
| InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
| CAS kay?t numaras? |
124-48-1 |
| EINECS |
204-704-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
2.504g/cm3 |
| Ergime noktas? |
-22℃ |
| Kaynama noktas? |
117.1°C at 760 mmHg |
| K?r?lma indisi |
1.561 |
| Alevlenme noktas? |
19.8°C |
| Buhar bas?nc? |
21mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|