124-48-1 Chlorodibromomethane
| Название продукта |
Chlorodibromomethane |
| Английское название |
Chlorodibromomethane; Dibromochloromethane |
| Молекулярная формула |
CHBr2Cl |
| Молекулярный вес |
208.2796 |
| InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
| Регистрационный номер CAS |
124-48-1 |
| EINECS |
204-704-0 |
| Молекулярная структура |
|
| Плотность |
2.504g/cm3 |
| Температура плавления |
-22℃ |
| Точка кипения |
117.1°C at 760 mmHg |
| Показатель преломления |
1.561 |
| Температура вспышки |
19.8°C |
| Давление пара |
21mmHg at 25°C |
| Символы опасности |
Xn:Harmful;
|
| Риск коды |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|