124-48-1 Chlorodibromomethane
| ??? ?????? |
Chlorodibromomethane |
| ????? ??????????? |
Chlorodibromomethane; Dibromochloromethane |
| ?????? ???????? |
CHBr2Cl |
| ????? ??????? ??????? |
208.2796 |
| InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
| ?????????? ???????? ??????? |
124-48-1 |
| ???????? ????????? ??? |
204-704-0 |
| ???? ?????? |
|
| ????? |
2.504g/cm3 |
| ???? ???????? |
-22℃ |
| ???? ??????? |
117.1°C at 760 mmHg |
| ????? ???????? |
1.561 |
| ???? ?????? |
19.8°C |
| ??? ?????? |
21mmHg at 25°C |
| ?????? ??? ??????? ?????? |
Xn:Harmful;
|
| ??? ????????? |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|