124-48-1 Chlorodibromomethane
| Naam product |
Chlorodibromomethane |
| Engelse naam |
Chlorodibromomethane; Dibromochloromethane |
| MF |
CHBr2Cl |
| Molecuulgewicht |
208.2796 |
| InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
| CAS-nummer |
124-48-1 |
| EINECS |
204-704-0 |
| Moleculaire Structuur |
|
| Dichtheid |
2.504g/cm3 |
| Smeltpunt |
-22℃ |
| Kookpunt |
117.1°C at 760 mmHg |
| Brekingsindex |
1.561 |
| Vlampunt |
19.8°C |
| Dampdruk |
21mmHg at 25°C |
| Gevaarsymbolen |
Xn:Harmful;
|
| Risico-codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|