124-48-1 Chlorodibromomethane
| název vyrobku |
Chlorodibromomethane |
| Anglicky název |
Chlorodibromomethane; Dibromochloromethane |
| Molekulární vzorec |
CHBr2Cl |
| Molekulová hmotnost |
208.2796 |
| InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
| Registra?ní ?íslo CAS |
124-48-1 |
| EINECS |
204-704-0 |
| Molekulární struktura |
|
| Hustota |
2.504g/cm3 |
| Bod tání |
-22℃ |
| Bod varu |
117.1°C at 760 mmHg |
| Index lomu |
1.561 |
| Bod vzplanutí |
19.8°C |
| Tlak par |
21mmHg at 25°C |
| Symbol? nebezpe?nosti |
Xn:Harmful;
|
| Riziko Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
| Bezpe?nostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|