124-48-1 Chlorodibromomethane
| Nome do produto |
Chlorodibromomethane |
| Nome em inglês |
Chlorodibromomethane; Dibromochloromethane |
| Fórmula molecular |
CHBr2Cl |
| Peso Molecular |
208.2796 |
| InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
| CAS Registry Number |
124-48-1 |
| EINECS |
204-704-0 |
| Estrutura Molecular |
|
| Densidade |
2.504g/cm3 |
| Ponto de fus?o |
-22℃ |
| Ponto de ebuli??o |
117.1°C at 760 mmHg |
| índice de refra??o |
1.561 |
| O ponto de inflama??o |
19.8°C |
| Press?o de vapor |
21mmHg at 25°C |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|