124-48-1 Chlorodibromomethane
| Ονομασ?α του προ??ντο? |
Chlorodibromomethane |
| Αγγλικ? ?νομα |
Chlorodibromomethane; Dibromochloromethane |
| MF |
CHBr2Cl |
| Μοριακ? β?ρο? |
208.2796 |
| InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
| CAS ΟΧΙ |
124-48-1 |
| EINECS |
204-704-0 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
2.504g/cm3 |
| Σημε?ο τ?ξη? |
-22℃ |
| Σημε?ο βρασμο? |
117.1°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.561 |
| Σημε?ο αν?φλεξη? |
19.8°C |
| Π?εση ατμ?ν |
21mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
Xn:Harmful;
|
| Κινδ?νου Κ?δικε? |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|