124-48-1 Chlorodibromomethane
| Nazwa produktu: |
Chlorodibromomethane |
| Angielska nazwa |
Chlorodibromomethane; Dibromochloromethane |
| MF |
CHBr2Cl |
| Masie cz?steczkowej |
208.2796 |
| InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
| Nr CAS |
124-48-1 |
| EINECS |
204-704-0 |
| Struktury molekularnej |
|
| G?sto?? |
2.504g/cm3 |
| Temperatura topnienia |
-22℃ |
| Temperatura wrzenia |
117.1°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.561 |
| Temperatura zap?onu |
19.8°C |
| Ci?nienie pary |
21mmHg at 25°C |
| Symbole zagro?enia |
Xn:Harmful;
|
| Kody ryzyka |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|