59-82-5 5-Nitro-2-furonitrile
| ürün Ad? |
5-Nitro-2-furonitrile |
| ingilizce ad? |
5-Nitro-2-furonitrile; 5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
| Moleküler Formülü |
C5H2N2O3 |
| Molekül A??rl??? |
138.081 |
| InChI |
InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| CAS kay?t numaras? |
59-82-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.46g/cm3 |
| Kaynama noktas? |
234.7°C at 760 mmHg |
| K?r?lma indisi |
1.544 |
| Alevlenme noktas? |
95.7°C |
| Buhar bas?nc? |
0.0522mmHg at 25°C |
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|