59-82-5 5-Nitro-2-furonitrile
| termék neve |
5-Nitro-2-furonitrile |
| Angol név |
5-Nitro-2-furonitrile; 5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
| MF |
C5H2N2O3 |
| Molekulat?meg |
138.081 |
| InChI |
InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| CAS-szám |
59-82-5 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.46g/cm3 |
| Forráspont |
234.7°C at 760 mmHg |
| T?résmutató |
1.544 |
| Gyulladáspont |
95.7°C |
| G?znyomás |
0.0522mmHg at 25°C |
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|