59-82-5 5-Nitro-2-furonitrile
| název vyrobku |
5-Nitro-2-furonitrile |
| Anglicky název |
5-Nitro-2-furonitrile; 5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
| Molekulární vzorec |
C5H2N2O3 |
| Molekulová hmotnost |
138.081 |
| InChI |
InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| Registra?ní ?íslo CAS |
59-82-5 |
| Molekulární struktura |
|
| Hustota |
1.46g/cm3 |
| Bod varu |
234.7°C at 760 mmHg |
| Index lomu |
1.544 |
| Bod vzplanutí |
95.7°C |
| Tlak par |
0.0522mmHg at 25°C |
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpe?nostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|