59-82-5 5-Nitro-2-furonitrile
| Naam product |
5-Nitro-2-furonitrile |
| Engelse naam |
5-Nitro-2-furonitrile; 5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
| MF |
C5H2N2O3 |
| Molecuulgewicht |
138.081 |
| InChI |
InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| CAS-nummer |
59-82-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.46g/cm3 |
| Kookpunt |
234.7°C at 760 mmHg |
| Brekingsindex |
1.544 |
| Vlampunt |
95.7°C |
| Dampdruk |
0.0522mmHg at 25°C |
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|