59-82-5 5-Nitro-2-furonitrile
| Nome do produto |
5-Nitro-2-furonitrile |
| Nome em inglês |
5-Nitro-2-furonitrile; 5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
| Fórmula molecular |
C5H2N2O3 |
| Peso Molecular |
138.081 |
| InChI |
InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| CAS Registry Number |
59-82-5 |
| Estrutura Molecular |
|
| Densidade |
1.46g/cm3 |
| Ponto de ebuli??o |
234.7°C at 760 mmHg |
| índice de refra??o |
1.544 |
| O ponto de inflama??o |
95.7°C |
| Press?o de vapor |
0.0522mmHg at 25°C |
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|