59-82-5 5-Nitro-2-furonitrile
| Nome del prodotto |
5-Nitro-2-furonitrile |
| Nome inglese |
5-Nitro-2-furonitrile; 5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
| Formula molecolare |
C5H2N2O3 |
| Peso Molecolare |
138.081 |
| InChI |
InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| Numero CAS |
59-82-5 |
| Struttura molecolare |
|
| Densità |
1.46g/cm3 |
| Punto di ebollizione |
234.7°C at 760 mmHg |
| Indice di rifrazione |
1.544 |
| Punto d'infiammabilità |
95.7°C |
| Pressione di vapore |
0.0522mmHg at 25°C |
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|