59-82-5 5-Nitro-2-furonitrile
| Nazwa produktu: |
5-Nitro-2-furonitrile |
| Angielska nazwa |
5-Nitro-2-furonitrile; 5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
| MF |
C5H2N2O3 |
| Masie cz?steczkowej |
138.081 |
| InChI |
InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| Nr CAS |
59-82-5 |
| Struktury molekularnej |
|
| G?sto?? |
1.46g/cm3 |
| Temperatura wrzenia |
234.7°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.544 |
| Temperatura zap?onu |
95.7°C |
| Ci?nienie pary |
0.0522mmHg at 25°C |
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|