5144-10-5 Pentamethylbenzonitrile
| ürün Ad? |
Pentamethylbenzonitrile |
| ingilizce ad? |
Pentamethylbenzonitrile; Penthamethylbenzonitrile |
| Moleküler Formülü |
C12H15N |
| Molekül A??rl??? |
173.2542 |
| InChI |
InChI=1/C12H15N/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h1-5H3 |
| CAS kay?t numaras? |
5144-10-5 |
| EINECS |
225-912-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.96g/cm3 |
| Ergime noktas? |
158-160℃ |
| Kaynama noktas? |
313.2°C at 760 mmHg |
| K?r?lma indisi |
1.515 |
| Alevlenme noktas? |
143.8°C |
| Buhar bas?nc? |
0.000503mmHg at 25°C |
| Risk Kodlar? |
R20/22:Harmful by inhalation and if swallowed.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|