5144-10-5 Pentamethylbenzonitrile
| product Name |
Pentamethylbenzonitrile |
| CAS No |
5144-10-5 |
| Synonyms |
Penthamethylbenzonitrile |
| Molecular Formula |
C12H15N |
| Molecular Weight |
173.2542 |
| InChI |
InChI=1/C12H15N/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h1-5H3 |
| EINECS |
225-912-8 |
| Molecular Structure |
|
| Density |
0.96g/cm3 |
| Melting point |
158-160℃ |
| Boiling point |
313.2°C at 760 mmHg |
| Refractive index |
1.515 |
| Flash point |
143.8°C |
| Vapour Pressur |
0.000503mmHg at 25°C |
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|