5144-10-5 Pentamethylbenzonitrile
| název vyrobku |
Pentamethylbenzonitrile |
| Anglicky název |
Pentamethylbenzonitrile; Penthamethylbenzonitrile |
| Molekulární vzorec |
C12H15N |
| Molekulová hmotnost |
173.2542 |
| InChI |
InChI=1/C12H15N/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h1-5H3 |
| Registra?ní ?íslo CAS |
5144-10-5 |
| EINECS |
225-912-8 |
| Molekulární struktura |
|
| Hustota |
0.96g/cm3 |
| Bod tání |
158-160℃ |
| Bod varu |
313.2°C at 760 mmHg |
| Index lomu |
1.515 |
| Bod vzplanutí |
143.8°C |
| Tlak par |
0.000503mmHg at 25°C |
| Riziko Codes |
R20/22:Harmful by inhalation and if swallowed.;
|
| Bezpe?nostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|