5144-10-5 Pentamethylbenzonitrile
| Ονομασ?α του προ??ντο? |
Pentamethylbenzonitrile |
| Αγγλικ? ?νομα |
Pentamethylbenzonitrile; Penthamethylbenzonitrile |
| MF |
C12H15N |
| Μοριακ? β?ρο? |
173.2542 |
| InChI |
InChI=1/C12H15N/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h1-5H3 |
| CAS ΟΧΙ |
5144-10-5 |
| EINECS |
225-912-8 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
0.96g/cm3 |
| Σημε?ο τ?ξη? |
158-160℃ |
| Σημε?ο βρασμο? |
313.2°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.515 |
| Σημε?ο αν?φλεξη? |
143.8°C |
| Π?εση ατμ?ν |
0.000503mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R20/22:Harmful by inhalation and if swallowed.;
|
| Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|