5144-10-5 Pentamethylbenzonitrile
| Nome do produto |
Pentamethylbenzonitrile |
| Nome em inglês |
Pentamethylbenzonitrile; Penthamethylbenzonitrile |
| Fórmula molecular |
C12H15N |
| Peso Molecular |
173.2542 |
| InChI |
InChI=1/C12H15N/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h1-5H3 |
| CAS Registry Number |
5144-10-5 |
| EINECS |
225-912-8 |
| Estrutura Molecular |
|
| Densidade |
0.96g/cm3 |
| Ponto de fus?o |
158-160℃ |
| Ponto de ebuli??o |
313.2°C at 760 mmHg |
| índice de refra??o |
1.515 |
| O ponto de inflama??o |
143.8°C |
| Press?o de vapor |
0.000503mmHg at 25°C |
| Códigos de risco |
R20/22:Harmful by inhalation and if swallowed.;
|
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|