5144-10-5 Pentamethylbenzonitrile
| Nome del prodotto |
Pentamethylbenzonitrile |
| Nome inglese |
Pentamethylbenzonitrile; Penthamethylbenzonitrile |
| Formula molecolare |
C12H15N |
| Peso Molecolare |
173.2542 |
| InChI |
InChI=1/C12H15N/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h1-5H3 |
| Numero CAS |
5144-10-5 |
| EINECS |
225-912-8 |
| Struttura molecolare |
|
| Densità |
0.96g/cm3 |
| Punto di fusione |
158-160℃ |
| Punto di ebollizione |
313.2°C at 760 mmHg |
| Indice di rifrazione |
1.515 |
| Punto d'infiammabilità |
143.8°C |
| Pressione di vapore |
0.000503mmHg at 25°C |
| Codici di Rischio |
R20/22:Harmful by inhalation and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|