5144-10-5 Pentamethylbenzonitrile
| Nazwa produktu: |
Pentamethylbenzonitrile |
| Angielska nazwa |
Pentamethylbenzonitrile; Penthamethylbenzonitrile |
| MF |
C12H15N |
| Masie cz?steczkowej |
173.2542 |
| InChI |
InChI=1/C12H15N/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h1-5H3 |
| Nr CAS |
5144-10-5 |
| EINECS |
225-912-8 |
| Struktury molekularnej |
|
| G?sto?? |
0.96g/cm3 |
| Temperatura topnienia |
158-160℃ |
| Temperatura wrzenia |
313.2°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.515 |
| Temperatura zap?onu |
143.8°C |
| Ci?nienie pary |
0.000503mmHg at 25°C |
| Kody ryzyka |
R20/22:Harmful by inhalation and if swallowed.;
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|