2005-08-5 4-chlorophenyl benzoate
| Nome do produto |
4-chlorophenyl benzoate |
| Nome em inglês |
4-chlorophenyl benzoate; 4-Chlorophenyl benzoate; benzoic acid 4-chlorophenyl ester |
| Fórmula molecular |
C13H9ClO2 |
| Peso Molecular |
232.6624 |
| InChI |
InChI=1/C13H9ClO2/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H |
| CAS Registry Number |
2005-08-5 |
| EINECS |
217-910-0 |
| Estrutura Molecular |
|
| Densidade |
1.258g/cm3 |
| Ponto de fus?o |
87-89℃ |
| Ponto de ebuli??o |
343.1°C at 760 mmHg |
| índice de refra??o |
1.594 |
| O ponto de inflama??o |
175.5°C |
| Press?o de vapor |
7.18E-05mmHg at 25°C |
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|