2005-08-5 4-chlorophenyl benzoate
| Nama produk |
4-chlorophenyl benzoate |
| Nama bahasa Inggris |
4-chlorophenyl benzoate; 4-Chlorophenyl benzoate; benzoic acid 4-chlorophenyl ester |
| MF |
C13H9ClO2 |
| Berat Molekul |
232.6624 |
| InChI |
InChI=1/C13H9ClO2/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H |
| CAS NO |
2005-08-5 |
| EINECS |
217-910-0 |
| Struktur Molekul |
|
| Kepadatan |
1.258g/cm3 |
| Titik lebur |
87-89℃ |
| Titik didih |
343.1°C at 760 mmHg |
| Indeks bias |
1.594 |
| Titik nyala |
175.5°C |
| Tekanan uap |
7.18E-05mmHg at 25°C |
| Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|