2005-08-5 4-chlorophenyl benzoate
| Nome del prodotto |
4-chlorophenyl benzoate |
| Nome inglese |
4-chlorophenyl benzoate; 4-Chlorophenyl benzoate; benzoic acid 4-chlorophenyl ester |
| Formula molecolare |
C13H9ClO2 |
| Peso Molecolare |
232.6624 |
| InChI |
InChI=1/C13H9ClO2/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H |
| Numero CAS |
2005-08-5 |
| EINECS |
217-910-0 |
| Struttura molecolare |
|
| Densità |
1.258g/cm3 |
| Punto di fusione |
87-89℃ |
| Punto di ebollizione |
343.1°C at 760 mmHg |
| Indice di rifrazione |
1.594 |
| Punto d'infiammabilità |
175.5°C |
| Pressione di vapore |
7.18E-05mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|