2005-08-5 4-chlorophenyl benzoate
| Produkt-Name |
4-chlorophenyl benzoate |
| Englischer Name |
4-chlorophenyl benzoate; 4-Chlorophenyl benzoate; benzoic acid 4-chlorophenyl ester |
| Molekulare Formel |
C13H9ClO2 |
| Molecular Weight |
232.6624 |
| InChI |
InChI=1/C13H9ClO2/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H |
| CAS Registry Number |
2005-08-5 |
| EINECS |
217-910-0 |
| Molecular Structure |
|
| Dichte |
1.258g/cm3 |
| Schmelzpunkt |
87-89℃ |
| Siedepunkt |
343.1°C at 760 mmHg |
| Brechungsindex |
1.594 |
| Flammpunkt |
175.5°C |
| Dampfdruck |
7.18E-05mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|