2005-08-5 4-chlorophenyl benzoate
| Nazwa produktu: |
4-chlorophenyl benzoate |
| Angielska nazwa |
4-chlorophenyl benzoate; 4-Chlorophenyl benzoate; benzoic acid 4-chlorophenyl ester |
| MF |
C13H9ClO2 |
| Masie cz?steczkowej |
232.6624 |
| InChI |
InChI=1/C13H9ClO2/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H |
| Nr CAS |
2005-08-5 |
| EINECS |
217-910-0 |
| Struktury molekularnej |
|
| G?sto?? |
1.258g/cm3 |
| Temperatura topnienia |
87-89℃ |
| Temperatura wrzenia |
343.1°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.594 |
| Temperatura zap?onu |
175.5°C |
| Ci?nienie pary |
7.18E-05mmHg at 25°C |
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|