2005-08-5 4-chlorophenyl benzoate
| product Name |
4-chlorophenyl benzoate |
| CAS No |
2005-08-5 |
| Synonyms |
4-Chlorophenyl benzoate; benzoic acid 4-chlorophenyl ester |
| Molecular Formula |
C13H9ClO2 |
| Molecular Weight |
232.6624 |
| InChI |
InChI=1/C13H9ClO2/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H |
| EINECS |
217-910-0 |
| Molecular Structure |
|
| Density |
1.258g/cm3 |
| Melting point |
87-89℃ |
| Boiling point |
343.1°C at 760 mmHg |
| Refractive index |
1.594 |
| Flash point |
175.5°C |
| Vapour Pressur |
7.18E-05mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|