2005-08-5 4-chlorophenyl benzoate
| Naam product |
4-chlorophenyl benzoate |
| Engelse naam |
4-chlorophenyl benzoate; 4-Chlorophenyl benzoate; benzoic acid 4-chlorophenyl ester |
| MF |
C13H9ClO2 |
| Molecuulgewicht |
232.6624 |
| InChI |
InChI=1/C13H9ClO2/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H |
| CAS-nummer |
2005-08-5 |
| EINECS |
217-910-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.258g/cm3 |
| Smeltpunt |
87-89℃ |
| Kookpunt |
343.1°C at 760 mmHg |
| Brekingsindex |
1.594 |
| Vlampunt |
175.5°C |
| Dampdruk |
7.18E-05mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|