589-62-8 4-octanol
| ürün Ad? |
4-octanol |
| ingilizce ad? |
4-octanol; n-Butyl n-propyl carbinol; octan-4-ol |
| Moleküler Formülü |
C8H18O |
| Molekül A??rl??? |
130.2279 |
| InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
| CAS kay?t numaras? |
589-62-8 |
| EINECS |
209-654-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.821g/cm3 |
| Kaynama noktas? |
179.2°C at 760 mmHg |
| K?r?lma indisi |
1.426 |
| Alevlenme noktas? |
71.1°C |
| Buhar bas?nc? |
0.284mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|