589-62-8 4-octanol
| Produkt-Name |
4-octanol |
| Englischer Name |
4-octanol; n-Butyl n-propyl carbinol; octan-4-ol |
| Molekulare Formel |
C8H18O |
| Molecular Weight |
130.2279 |
| InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
| CAS Registry Number |
589-62-8 |
| EINECS |
209-654-3 |
| Molecular Structure |
|
| Dichte |
0.821g/cm3 |
| Siedepunkt |
179.2°C at 760 mmHg |
| Brechungsindex |
1.426 |
| Flammpunkt |
71.1°C |
| Dampfdruck |
0.284mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|