589-62-8 4-octanol
| Naam product |
4-octanol |
| Engelse naam |
4-octanol; n-Butyl n-propyl carbinol; octan-4-ol |
| MF |
C8H18O |
| Molecuulgewicht |
130.2279 |
| InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
| CAS-nummer |
589-62-8 |
| EINECS |
209-654-3 |
| Moleculaire Structuur |
|
| Dichtheid |
0.821g/cm3 |
| Kookpunt |
179.2°C at 760 mmHg |
| Brekingsindex |
1.426 |
| Vlampunt |
71.1°C |
| Dampdruk |
0.284mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|