589-62-8 4-octanol
| Nama produk |
4-octanol |
| Nama bahasa Inggris |
4-octanol; n-Butyl n-propyl carbinol; octan-4-ol |
| MF |
C8H18O |
| Berat Molekul |
130.2279 |
| InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
| CAS NO |
589-62-8 |
| EINECS |
209-654-3 |
| Struktur Molekul |
|
| Kepadatan |
0.821g/cm3 |
| Titik didih |
179.2°C at 760 mmHg |
| Indeks bias |
1.426 |
| Titik nyala |
71.1°C |
| Tekanan uap |
0.284mmHg at 25°C |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|