589-62-8 4-octanol
| ?????? ?? ??? |
4-octanol |
| ???????? ??? |
4-octanol; n-Butyl n-propyl carbinol; octan-4-ol |
| ????? ???????? |
C8H18O |
| ?????? ??? |
130.2279 |
| InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
| ??? ??????? ?????? |
589-62-8 |
| EINECS |
209-654-3 |
| ????? ?????? |
|
| ????? |
0.821g/cm3 |
| ????? ?? ??? |
179.2°C at 760 mmHg |
| ??????? ??????? |
1.426 |
| ????? ??????? |
71.1°C |
| ????? ?? ???? |
0.284mmHg at 25°C |
| ???? ?? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|