589-62-8 4-octanol
| Nome del prodotto |
4-octanol |
| Nome inglese |
4-octanol; n-Butyl n-propyl carbinol; octan-4-ol |
| Formula molecolare |
C8H18O |
| Peso Molecolare |
130.2279 |
| InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
| Numero CAS |
589-62-8 |
| EINECS |
209-654-3 |
| Struttura molecolare |
|
| Densità |
0.821g/cm3 |
| Punto di ebollizione |
179.2°C at 760 mmHg |
| Indice di rifrazione |
1.426 |
| Punto d'infiammabilità |
71.1°C |
| Pressione di vapore |
0.284mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|