2113-58-8 3-Nitrobiphenyl
| ürün Ad? |
3-Nitrobiphenyl |
| ingilizce ad? |
3-Nitrobiphenyl; 3-Nitrodiphenyl |
| Moleküler Formülü |
C12H9NO2 |
| Molekül A??rl??? |
199.2054 |
| InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| CAS kay?t numaras? |
2113-58-8 |
| EINECS |
218-305-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.196g/cm3 |
| Ergime noktas? |
56-60℃ |
| Kaynama noktas? |
339°C at 760 mmHg |
| K?r?lma indisi |
1.605 |
| Alevlenme noktas? |
161.4°C |
| Buhar bas?nc? |
0.000186mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R40:Possible risks of irreversible effects.;
|
| Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|