2113-58-8 3-Nitrobiphenyl
| ??? ?????? |
3-Nitrobiphenyl |
| ????? ??????????? |
3-Nitrobiphenyl; 3-Nitrodiphenyl |
| ?????? ???????? |
C12H9NO2 |
| ????? ??????? ??????? |
199.2054 |
| InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| ?????????? ???????? ??????? |
2113-58-8 |
| ???????? ????????? ??? |
218-305-4 |
| ???? ?????? |
|
| ????? |
1.196g/cm3 |
| ???? ???????? |
56-60℃ |
| ???? ??????? |
339°C at 760 mmHg |
| ????? ???????? |
1.605 |
| ???? ?????? |
161.4°C |
| ??? ?????? |
0.000186mmHg at 25°C |
| ?????? ??? ??????? ?????? |
Xn:Harmful;
|
| ??? ????????? |
R40:Possible risks of irreversible effects.;
|
| ???? ????? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|