2113-58-8 3-Nitrobiphenyl
| termék neve |
3-Nitrobiphenyl |
| Angol név |
3-Nitrobiphenyl; 3-Nitrodiphenyl |
| MF |
C12H9NO2 |
| Molekulat?meg |
199.2054 |
| InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| CAS-szám |
2113-58-8 |
| EINECS |
218-305-4 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.196g/cm3 |
| Olvadáspont |
56-60℃ |
| Forráspont |
339°C at 760 mmHg |
| T?résmutató |
1.605 |
| Gyulladáspont |
161.4°C |
| G?znyomás |
0.000186mmHg at 25°C |
| Veszély szimbólumok |
Xn:Harmful;
|
| Kockázatot kódok |
R40:Possible risks of irreversible effects.;
|
| Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|