2113-58-8 3-Nitrobiphenyl
| Produkt-Name |
3-Nitrobiphenyl |
| Englischer Name |
3-Nitrobiphenyl; 3-Nitrodiphenyl |
| Molekulare Formel |
C12H9NO2 |
| Molecular Weight |
199.2054 |
| InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| CAS Registry Number |
2113-58-8 |
| EINECS |
218-305-4 |
| Molecular Structure |
|
| Dichte |
1.196g/cm3 |
| Schmelzpunkt |
56-60℃ |
| Siedepunkt |
339°C at 760 mmHg |
| Brechungsindex |
1.605 |
| Flammpunkt |
161.4°C |
| Dampfdruck |
0.000186mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R40:Possible risks of irreversible effects.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|