2113-58-8 3-Nitrobiphenyl
| Nazwa produktu: |
3-Nitrobiphenyl |
| Angielska nazwa |
3-Nitrobiphenyl; 3-Nitrodiphenyl |
| MF |
C12H9NO2 |
| Masie cz?steczkowej |
199.2054 |
| InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| Nr CAS |
2113-58-8 |
| EINECS |
218-305-4 |
| Struktury molekularnej |
|
| G?sto?? |
1.196g/cm3 |
| Temperatura topnienia |
56-60℃ |
| Temperatura wrzenia |
339°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.605 |
| Temperatura zap?onu |
161.4°C |
| Ci?nienie pary |
0.000186mmHg at 25°C |
| Symbole zagro?enia |
Xn:Harmful;
|
| Kody ryzyka |
R40:Possible risks of irreversible effects.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|