2113-58-8 3-Nitrobiphenyl
| Ονομασ?α του προ??ντο? |
3-Nitrobiphenyl |
| Αγγλικ? ?νομα |
3-Nitrobiphenyl; 3-Nitrodiphenyl |
| MF |
C12H9NO2 |
| Μοριακ? β?ρο? |
199.2054 |
| InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| CAS ΟΧΙ |
2113-58-8 |
| EINECS |
218-305-4 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.196g/cm3 |
| Σημε?ο τ?ξη? |
56-60℃ |
| Σημε?ο βρασμο? |
339°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.605 |
| Σημε?ο αν?φλεξη? |
161.4°C |
| Π?εση ατμ?ν |
0.000186mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
Xn:Harmful;
|
| Κινδ?νου Κ?δικε? |
R40:Possible risks of irreversible effects.;
|
| Περιγραφ? τη? ασφ?λεια? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|