75-27-4 Bromodichloromethane
| ürün Ad? |
Bromodichloromethane |
| ingilizce ad? |
Bromodichloromethane; FC-20B1 |
| Moleküler Formülü |
CHBrCl2 |
| Molekül A??rl??? |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| CAS kay?t numaras? |
75-27-4 |
| EINECS |
200-856-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
2.013g/cm3 |
| Ergime noktas? |
-55℃ |
| Kaynama noktas? |
89.7°C at 760 mmHg |
| K?r?lma indisi |
1.503 |
| Alevlenme noktas? |
1.3°C |
| Buhar bas?nc? |
65.3mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|