75-27-4 Bromodichloromethane
| Nama produk |
Bromodichloromethane |
| Nama Inggeris |
Bromodichloromethane; FC-20B1 |
| MF |
CHBrCl2 |
| Berat Molekul |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| CAS NO |
75-27-4 |
| EINECS |
200-856-7 |
| Struktur Molekul |
|
| Kepadatan |
2.013g/cm3 |
| Titik lebur |
-55℃ |
| Titik didih |
89.7°C at 760 mmHg |
| Indeks bias |
1.503 |
| Titik nyala |
1.3°C |
| Tekanan wap |
65.3mmHg at 25°C |
| Cinta bahaya |
Xn:Harmful;
|
| Kod Risiko |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|