75-27-4 Bromodichloromethane
| ??? ????? |
Bromodichloromethane |
| ??? ??????? |
Bromodichloromethane; FC-20B1 |
| ????? ???????? |
CHBrCl2 |
| ??? ??????? |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| ????? ?????? |
75-27-4 |
| ????? ??????? ??????? |
200-856-7 |
| ?????? ??????? |
|
| ????? |
2.013g/cm3 |
| ???? ??? |
-55℃ |
| ???? ????? |
89.7°C at 760 mmHg |
| ???? ???? |
1.503 |
| ???? ?????? |
1.3°C |
| ???? ???? |
65.3mmHg at 25°C |
| ??? ?????? |
Xn:Harmful;
|
| ????? ??? |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| ??????? ????? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|