75-27-4 Bromodichloromethane
| ?? ????? |
Bromodichloromethane |
| ?? ????? |
Bromodichloromethane; FC-20B1 |
| ????????? ??????? |
CHBrCl2 |
| ???? ???????? |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| ???? CAS |
75-27-4 |
| EINECS |
200-856-7 |
| ???? ???????? |
|
| ?????? |
2.013g/cm3 |
| ????? ????? |
-55℃ |
| ????? ????? |
89.7°C at 760 mmHg |
| ???? ????? |
1.503 |
| ????? ???? |
1.3°C |
| ??? ???? |
65.3mmHg at 25°C |
| Hazard ?????? |
Xn:Harmful;
|
| ??????? ???? |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| ?????? ????? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|