75-27-4 Bromodichloromethane
| Ονομασ?α του προ??ντο? |
Bromodichloromethane |
| Αγγλικ? ?νομα |
Bromodichloromethane; FC-20B1 |
| MF |
CHBrCl2 |
| Μοριακ? β?ρο? |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| CAS ΟΧΙ |
75-27-4 |
| EINECS |
200-856-7 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
2.013g/cm3 |
| Σημε?ο τ?ξη? |
-55℃ |
| Σημε?ο βρασμο? |
89.7°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.503 |
| Σημε?ο αν?φλεξη? |
1.3°C |
| Π?εση ατμ?ν |
65.3mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
Xn:Harmful;
|
| Κινδ?νου Κ?δικε? |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Περιγραφ? τη? ασφ?λεια? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|