75-27-4 Bromodichloromethane
| Nome del prodotto |
Bromodichloromethane |
| Nome inglese |
Bromodichloromethane; FC-20B1 |
| Formula molecolare |
CHBrCl2 |
| Peso Molecolare |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| Numero CAS |
75-27-4 |
| EINECS |
200-856-7 |
| Struttura molecolare |
|
| Densità |
2.013g/cm3 |
| Punto di fusione |
-55℃ |
| Punto di ebollizione |
89.7°C at 760 mmHg |
| Indice di rifrazione |
1.503 |
| Punto d'infiammabilità |
1.3°C |
| Pressione di vapore |
65.3mmHg at 25°C |
| Simboli di pericolo |
Xn:Harmful;
|
| Codici di Rischio |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|