75-27-4 Bromodichloromethane
| Nazwa produktu: |
Bromodichloromethane |
| Angielska nazwa |
Bromodichloromethane; FC-20B1 |
| MF |
CHBrCl2 |
| Masie cz?steczkowej |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| Nr CAS |
75-27-4 |
| EINECS |
200-856-7 |
| Struktury molekularnej |
|
| G?sto?? |
2.013g/cm3 |
| Temperatura topnienia |
-55℃ |
| Temperatura wrzenia |
89.7°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.503 |
| Temperatura zap?onu |
1.3°C |
| Ci?nienie pary |
65.3mmHg at 25°C |
| Symbole zagro?enia |
Xn:Harmful;
|
| Kody ryzyka |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|