86-26-0 2-Methoxybiphenyl
| ürün Ad? |
2-Methoxybiphenyl |
| ingilizce ad? |
2-Methoxybiphenyl; 2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
| Moleküler Formülü |
C13H12O |
| Molekül A??rl??? |
184.2338 |
| InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| CAS kay?t numaras? |
86-26-0 |
| EINECS |
201-659-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.03g/cm3 |
| Ergime noktas? |
30-33℃ |
| Kaynama noktas? |
274°C at 760 mmHg |
| K?r?lma indisi |
1.556 |
| Alevlenme noktas? |
101.3°C |
| Buhar bas?nc? |
0.00928mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R33:Danger of cummulative effects.;
|
| Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|