86-26-0 2-Methoxybiphenyl
| produktnavn |
2-Methoxybiphenyl |
| Engelsk navn |
2-Methoxybiphenyl; 2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
| Molekyl?r Formel |
C13H12O |
| Molekylvekt |
184.2338 |
| InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| CAS-nummer |
86-26-0 |
| EINECS |
201-659-9 |
| Molecular Structure |
|
| Tetthet |
1.03g/cm3 |
| Smeltepunkt |
30-33℃ |
| Kokepunkt |
274°C at 760 mmHg |
| Brytningsindeks |
1.556 |
| Flammepunktet |
101.3°C |
| Damptrykk |
0.00928mmHg at 25°C |
| Hazard symboler |
Xn:Harmful;
|
| Risiko Koder |
R33:Danger of cummulative effects.;
|
| Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|